C13H13F2NOS — CID 117426441
2,5-difluoro-1-(1-isocyanatocyclopentyl)-3-methylsulfanylbenzene (PubChem CID 117426441) has the molecular formula C13H13F2NOS and a molecular weight of 269.32 g/mol. Its IUPAC name is 2,5-difluoro-1-(1-isocyanatocyclopentyl)-3-methylsulfanylbenzene.
| Compound Name | 2,5-difluoro-1-(1-isocyanatocyclopentyl)-3-methylsulfanylbenzene |
|---|---|
| PubChem CID | 117426441 |
| Molecular Formula | C13H13F2NOS |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2,5-difluoro-1-(1-isocyanatocyclopentyl)-3-methylsulfanylbenzene |
| SMILES | CSc1cc(F)cc(C2(N=C=O)CCCC2)c1F |
| InChI | InChI=1S/C13H13F2NOS/c1-18-11-7-9(14)6-10(12(11)15)13(16-8-17)4-2-3-5-13/h6-7H,2-5H2,1H3 |
| InChIKey | CWXQDMJTWFAWHV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|