C15H19NOS2 — CID 117473717
1-(1-isocyanatocyclopentyl)-4-methyl-2,5-bis(methylsulfanyl)benzene (PubChem CID 117473717) has the molecular formula C15H19NOS2 and a molecular weight of 293.46 g/mol. Its IUPAC name is 1-(1-isocyanatocyclopentyl)-4-methyl-2,5-bis(methylsulfanyl)benzene.
| Compound Name | 1-(1-isocyanatocyclopentyl)-4-methyl-2,5-bis(methylsulfanyl)benzene |
|---|---|
| PubChem CID | 117473717 |
| Molecular Formula | C15H19NOS2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-(1-isocyanatocyclopentyl)-4-methyl-2,5-bis(methylsulfanyl)benzene |
| SMILES | CSc1cc(C2(N=C=O)CCCC2)c(SC)cc1C |
| InChI | InChI=1S/C15H19NOS2/c1-11-8-14(19-3)12(9-13(11)18-2)15(16-10-17)6-4-5-7-15/h8-9H,4-7H2,1-3H3 |
| InChIKey | SNGIULHLPNRASU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|