C12H14O4S2 — CID 117461992
1-(3-methylsulfanyl-4-methylsulfonylphenyl)cyclopropane-1-carboxylic acid (PubChem CID 117461992) has the molecular formula C12H14O4S2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-(3-methylsulfanyl-4-methylsulfonylphenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(3-methylsulfanyl-4-methylsulfonylphenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117461992 |
| Molecular Formula | C12H14O4S2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1-(3-methylsulfanyl-4-methylsulfonylphenyl)cyclopropane-1-carboxylic acid |
| SMILES | CSc1cc(C2(C(=O)O)CC2)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C12H14O4S2/c1-17-9-7-8(12(5-6-12)11(13)14)3-4-10(9)18(2,15)16/h3-4,7H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | BKPAVGCESVNAJI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |