C14H21NS3 — CID 117482555
1-[3,4,5-tris(methylsulfanyl)phenyl]cyclopentan-1-amine (PubChem CID 117482555) has the molecular formula C14H21NS3 and a molecular weight of 299.53 g/mol. Its IUPAC name is 1-[3,4,5-tris(methylsulfanyl)phenyl]cyclopentan-1-amine.
| Compound Name | 1-[3,4,5-tris(methylsulfanyl)phenyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 117482555 |
| Molecular Formula | C14H21NS3 |
| Molecular Weight | 299.53 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-[3,4,5-tris(methylsulfanyl)phenyl]cyclopentan-1-amine |
| SMILES | CSc1cc(C2(N)CCCC2)cc(SC)c1SC |
| InChI | InChI=1S/C14H21NS3/c1-16-11-8-10(14(15)6-4-5-7-14)9-12(17-2)13(11)18-3/h8-9H,4-7,15H2,1-3H3 |
| InChIKey | LXOOMCVZESHWLG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |