C18H26O2 — CID 117438771
1-(2-pentan-3-ylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117438771) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-(2-pentan-3-ylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-pentan-3-ylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117438771 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-(2-pentan-3-ylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | CCC(CC)c1ccccc1C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H26O2/c1-3-14(4-2)15-10-6-7-11-16(15)18(17(19)20)12-8-5-9-13-18/h6-7,10-11,14H,3-5,8-9,12-13H2,1-2H3,(H,19,20) |
| InChIKey | NAXLENPUVXOZIY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |