C18H23FO — CID 143134266
(2E,4E)-5-[1-(3-fluorophenyl)cyclohexyl]hexa-2,4-dien-2-ol (PubChem CID 143134266) has the molecular formula C18H23FO and a molecular weight of 274.38 g/mol. Its IUPAC name is (2E,4E)-5-[1-(3-fluorophenyl)cyclohexyl]hexa-2,4-dien-2-ol.
| Compound Name | (2E,4E)-5-[1-(3-fluorophenyl)cyclohexyl]hexa-2,4-dien-2-ol |
|---|---|
| PubChem CID | 143134266 |
| Molecular Formula | C18H23FO |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (2E,4E)-5-[1-(3-fluorophenyl)cyclohexyl]hexa-2,4-dien-2-ol |
| SMILES | C/C(O)=C\C=C(/C)C1(c2cccc(F)c2)CCCCC1 |
| InChI | InChI=1S/C18H23FO/c1-14(9-10-15(2)20)18(11-4-3-5-12-18)16-7-6-8-17(19)13-16/h6-10,13,20H,3-5,11-12H2,1-2H3/b14-9+,15-10+ |
| InChIKey | GMSJYOPXSDPJGC-AOEKMSOUSA-N |
| XLogP | 5.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|