C22H36O2 — CID 143134277
1-[(E)-but-2-en-2-yl]-1-phenylcycloheptane;ethane;(Z)-prop-1-ene-1,2-diol (PubChem CID 143134277) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-1-phenylcycloheptane;ethane;(Z)-prop-1-ene-1,2-diol.
| Compound Name | 1-[(E)-but-2-en-2-yl]-1-phenylcycloheptane;ethane;(Z)-prop-1-ene-1,2-diol |
|---|---|
| PubChem CID | 143134277 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-1-phenylcycloheptane;ethane;(Z)-prop-1-ene-1,2-diol |
| SMILES | C/C(O)=C/O.C/C=C(\C)C1(c2ccccc2)CCCCCC1.CC |
| InChI | InChI=1S/C17H24.C3H6O2.C2H6/c1-3-15(2)17(13-9-4-5-10-14-17)16-11-7-6-8-12-16;1-3(5)2-4;1-2/h3,6-8,11-12H,4-5,9-10,13-14H2,1-2H3;2,4-5H,1H3;1-2H3/b15-3+;3-2-; |
| InChIKey | VWFFHALWQPBZNE-HYULKQSVSA-N |
| XLogP | 7.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|