C19H24O — CID 143461732
(3Z,5E)-5-(1-phenylcyclohexyl)hepta-1,3,5-trien-2-ol (PubChem CID 143461732) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (3Z,5E)-5-(1-phenylcyclohexyl)hepta-1,3,5-trien-2-ol.
| Compound Name | (3Z,5E)-5-(1-phenylcyclohexyl)hepta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 143461732 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (3Z,5E)-5-(1-phenylcyclohexyl)hepta-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C/C)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H24O/c1-3-17(13-12-16(2)20)19(14-8-5-9-15-19)18-10-6-4-7-11-18/h3-4,6-7,10-13,20H,2,5,8-9,14-15H2,1H3/b13-12-,17-3+ |
| InChIKey | NSDBUWSRRAMWTO-AYEHTEFMSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|