C18H24 — CID 143134347
(1-hexa-1,5-dien-2-ylcyclohexyl)benzene (PubChem CID 143134347) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is (1-hexa-1,5-dien-2-ylcyclohexyl)benzene.
| Compound Name | (1-hexa-1,5-dien-2-ylcyclohexyl)benzene |
|---|---|
| PubChem CID | 143134347 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (1-hexa-1,5-dien-2-ylcyclohexyl)benzene |
| SMILES | C=CCCC(=C)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H24/c1-3-4-11-16(2)18(14-9-6-10-15-18)17-12-7-5-8-13-17/h3,5,7-8,12-13H,1-2,4,6,9-11,14-15H2 |
| InChIKey | WNCQKFWULDZSGS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|