C15H18ClNO — CID 115636963
N-(2-chloroprop-2-enyl)-1-phenylcyclopentane-1-carboxamide (PubChem CID 115636963) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-1-phenylcyclopentane-1-carboxamide.
| Compound Name | N-(2-chloroprop-2-enyl)-1-phenylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 115636963 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-1-phenylcyclopentane-1-carboxamide |
| SMILES | C=C(Cl)CNC(=O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C15H18ClNO/c1-12(16)11-17-14(18)15(9-5-6-10-15)13-7-3-2-4-8-13/h2-4,7-8H,1,5-6,9-11H2,(H,17,18) |
| InChIKey | WWGASPSORWZCHT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |