C20H23NOS — CID 39630901
1-phenyl-N-(2-phenylsulfanylethyl)cyclopentane-1-carboxamide (PubChem CID 39630901) has the molecular formula C20H23NOS and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-phenyl-N-(2-phenylsulfanylethyl)cyclopentane-1-carboxamide.
| Compound Name | 1-phenyl-N-(2-phenylsulfanylethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 39630901 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-phenyl-N-(2-phenylsulfanylethyl)cyclopentane-1-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H23NOS/c22-19(21-15-16-23-18-11-5-2-6-12-18)20(13-7-8-14-20)17-9-3-1-4-10-17/h1-6,9-12H,7-8,13-16H2,(H,21,22) |
| InChIKey | AHKDKZOJQYSXBP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|