C20H27NO — CID 43021008
N-[2-(cyclohexen-1-yl)ethyl]-1-phenylcyclopentane-1-carboxamide (PubChem CID 43021008) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-phenylcyclopentane-1-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-phenylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 43021008 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-phenylcyclopentane-1-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H27NO/c22-19(21-16-13-17-9-3-1-4-10-17)20(14-7-8-15-20)18-11-5-2-6-12-18/h2,5-6,9,11-12H,1,3-4,7-8,10,13-16H2,(H,21,22) |
| InChIKey | VINFTSJQWPROGS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|