C20H26 — CID 142142830
[1-[1-(2-cyclopropylcyclopropyl)ethenyl]cyclohexyl]benzene (PubChem CID 142142830) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is [1-[1-(2-cyclopropylcyclopropyl)ethenyl]cyclohexyl]benzene.
| Compound Name | [1-[1-(2-cyclopropylcyclopropyl)ethenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 142142830 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | [1-[1-(2-cyclopropylcyclopropyl)ethenyl]cyclohexyl]benzene |
| SMILES | C=C(C1CC1C1CC1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H26/c1-15(18-14-19(18)16-10-11-16)20(12-6-3-7-13-20)17-8-4-2-5-9-17/h2,4-5,8-9,16,18-19H,1,3,6-7,10-14H2 |
| InChIKey | HMVFIBWOEUKWMQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|