C19H28O — CID 10564133
(1S,2S,12S)-2-phenylbicyclo[10.1.0]tridecan-2-ol (PubChem CID 10564133) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1S,2S,12S)-2-phenylbicyclo[10.1.0]tridecan-2-ol.
| Compound Name | (1S,2S,12S)-2-phenylbicyclo[10.1.0]tridecan-2-ol |
|---|---|
| PubChem CID | 10564133 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1S,2S,12S)-2-phenylbicyclo[10.1.0]tridecan-2-ol |
| SMILES | O[C@@]1(c2ccccc2)CCCCCCCCC[C@H]2C[C@@H]21 |
| InChI | InChI=1S/C19H28O/c20-19(17-12-8-6-9-13-17)14-10-5-3-1-2-4-7-11-16-15-18(16)19/h6,8-9,12-13,16,18,20H,1-5,7,10-11,14-15H2/t16-,18-,19+/m0/s1 |
| InChIKey | JTTJTNQOMFPDSV-YTQUADARSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |