About [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate
[(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate (PubChem CID 164678101) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate.
Molecular Properties
| Compound Name | [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate |
| PubChem CID | 164678101 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate |
| SMILES | CC(=O)O[C@H]1CCCCC[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-12(16)18-14-10-6-3-7-11-15(14,17)13-8-4-2-5-9-13/h2,4-5,8-9,14,17H,3,6-7,10-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | AVVQUFHGMZSDCH-GJZGRUSLSA-N |
| XLogP | 2.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate?
The IUPAC name of [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate (CID 164678101) is [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate.
What is the SMILES notation for [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate?
The canonical SMILES for [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate is CC(=O)O[C@H]1CCCCC[C@]1(O)c1ccccc1.
What is the InChIKey of [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate?
The InChIKey is AVVQUFHGMZSDCH-GJZGRUSLSA-N. The full InChI is InChI=1S/C15H20O3/c1-12(16)18-14-10-6-3-7-11-15(14,17)13-8-4-2-5-9-13/h2,4-5,8-9,14,17H,3,6-7,10-11H2,1H3/t14-,15-/m0/s1.
What are the key properties of [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate?
[(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate has a molecular weight of 248.32 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-hydroxy-2-phenylcycloheptyl] acetate is sourced from PubChem (CID 164678101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).