C15H19BrO3 — CID 23240222
[(1R,2R)-2-[3-(bromomethyl)phenyl]-2-hydroxycyclohexyl] acetate (PubChem CID 23240222) has the molecular formula C15H19BrO3 and a molecular weight of 327.22 g/mol. Its IUPAC name is [(1R,2R)-2-[3-(bromomethyl)phenyl]-2-hydroxycyclohexyl] acetate.
| Compound Name | [(1R,2R)-2-[3-(bromomethyl)phenyl]-2-hydroxycyclohexyl] acetate |
|---|---|
| PubChem CID | 23240222 |
| Molecular Formula | C15H19BrO3 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [(1R,2R)-2-[3-(bromomethyl)phenyl]-2-hydroxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCCC[C@@]1(O)c1cccc(CBr)c1 |
| InChI | InChI=1S/C15H19BrO3/c1-11(17)19-14-7-2-3-8-15(14,18)13-6-4-5-12(9-13)10-16/h4-6,9,14,18H,2-3,7-8,10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | AOABJYKRQAZEFU-HUUCEWRRSA-N |
| XLogP | 3.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|