C28H38O11S — CID 23240230
methyl 2-[[3-[(1R,2R)-1-hydroxy-2-[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxycyclohexyl]phenyl]methylsulfanyl]acetate (PubChem CID 23240230) has the molecular formula C28H38O11S and a molecular weight of 582.67 g/mol. Its IUPAC name is methyl 2-[[3-[(1R,2R)-1-hydroxy-2-[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxycyclohexyl]phenyl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[3-[(1R,2R)-1-hydroxy-2-[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxycyclohexyl]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 23240230 |
| Molecular Formula | C28H38O11S |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | methyl 2-[[3-[(1R,2R)-1-hydroxy-2-[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxycyclohexyl]phenyl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSCc1cccc([C@]2(O)CCCC[C@H]2O[C@@H]2O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)c1 |
| InChI | InChI=1S/C28H38O11S/c1-16-24(36-17(2)29)25(37-18(3)30)26(38-19(4)31)27(35-16)39-22-11-6-7-12-28(22,33)21-10-8-9-20(13-21)14-40-15-23(32)34-5/h8-10,13,16,22,24-27,33H,6-7,11-12,14-15H2,1-5H3/t16-,22+,24+,25+,26-,27-,28+/m0/s1 |
| InChIKey | FMLNVSGPKNZQRR-AQJWWXDXSA-N |
| XLogP | 2.78 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|