C17H22O5 — CID 24879603
benzyl 2-[(1S,2S)-2-acetyloxy-1-hydroxycyclohexyl]acetate (PubChem CID 24879603) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is benzyl 2-[(1S,2S)-2-acetyloxy-1-hydroxycyclohexyl]acetate.
| Compound Name | benzyl 2-[(1S,2S)-2-acetyloxy-1-hydroxycyclohexyl]acetate |
|---|---|
| PubChem CID | 24879603 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | benzyl 2-[(1S,2S)-2-acetyloxy-1-hydroxycyclohexyl]acetate |
| SMILES | CC(=O)O[C@H]1CCCC[C@]1(O)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22O5/c1-13(18)22-15-9-5-6-10-17(15,20)11-16(19)21-12-14-7-3-2-4-8-14/h2-4,7-8,15,20H,5-6,9-12H2,1H3/t15-,17-/m0/s1 |
| InChIKey | DNPBBVIMNZMHAR-RDJZCZTQSA-N |
| XLogP | 2.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |