C18H22O3 — CID 139435565
benzyl 2-methylidene-1-(2-oxopropyl)cyclohexane-1-carboxylate (PubChem CID 139435565) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is benzyl 2-methylidene-1-(2-oxopropyl)cyclohexane-1-carboxylate.
| Compound Name | benzyl 2-methylidene-1-(2-oxopropyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139435565 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | benzyl 2-methylidene-1-(2-oxopropyl)cyclohexane-1-carboxylate |
| SMILES | C=C1CCCCC1(CC(C)=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H22O3/c1-14-8-6-7-11-18(14,12-15(2)19)17(20)21-13-16-9-4-3-5-10-16/h3-5,9-10H,1,6-8,11-13H2,2H3 |
| InChIKey | SEMPKOMGEJXWQZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|