C21H26O4 — CID 139435567
benzyl (1R)-2-methylidene-1,3-bis(2-oxopropyl)cyclohexane-1-carboxylate (PubChem CID 139435567) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is benzyl (1R)-2-methylidene-1,3-bis(2-oxopropyl)cyclohexane-1-carboxylate.
| Compound Name | benzyl (1R)-2-methylidene-1,3-bis(2-oxopropyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139435567 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | benzyl (1R)-2-methylidene-1,3-bis(2-oxopropyl)cyclohexane-1-carboxylate |
| SMILES | C=C1C(CC(C)=O)CCC[C@]1(CC(C)=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H26O4/c1-15(22)12-19-10-7-11-21(17(19)3,13-16(2)23)20(24)25-14-18-8-5-4-6-9-18/h4-6,8-9,19H,3,7,10-14H2,1-2H3/t19?,21-/m1/s1 |
| InChIKey | ULTBZGFGXQXXAP-VGAJERRHSA-N |
| XLogP | 4.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|