C20H22O4 — CID 146233710
benzyl 2-oxo-1-(2-oxopropyl)-3-prop-2-ynylcyclohexane-1-carboxylate (PubChem CID 146233710) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is benzyl 2-oxo-1-(2-oxopropyl)-3-prop-2-ynylcyclohexane-1-carboxylate.
| Compound Name | benzyl 2-oxo-1-(2-oxopropyl)-3-prop-2-ynylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 146233710 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | benzyl 2-oxo-1-(2-oxopropyl)-3-prop-2-ynylcyclohexane-1-carboxylate |
| SMILES | C#CCC1CCCC(CC(C)=O)(C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H22O4/c1-3-8-17-11-7-12-20(18(17)22,13-15(2)21)19(23)24-14-16-9-5-4-6-10-16/h1,4-6,9-10,17H,7-8,11-14H2,2H3 |
| InChIKey | MOJIUPMCQXCHMM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|