C20H24O4 — CID 134176108
benzyl (10aS)-2-oxo-4,5,6,6a,7,8,9,10-octahydro-3H-benzo[h][1]benzofuran-3a-carboxylate (PubChem CID 134176108) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is benzyl (10aS)-2-oxo-4,5,6,6a,7,8,9,10-octahydro-3H-benzo[h][1]benzofuran-3a-carboxylate.
| Compound Name | benzyl (10aS)-2-oxo-4,5,6,6a,7,8,9,10-octahydro-3H-benzo[h][1]benzofuran-3a-carboxylate |
|---|---|
| PubChem CID | 134176108 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | benzyl (10aS)-2-oxo-4,5,6,6a,7,8,9,10-octahydro-3H-benzo[h][1]benzofuran-3a-carboxylate |
| SMILES | O=C1CC2(C(=O)OCc3ccccc3)CCCC3CCCC[C@]32O1 |
| InChI | InChI=1S/C20H24O4/c21-17-13-19(18(22)23-14-15-7-2-1-3-8-15)11-6-10-16-9-4-5-12-20(16,19)24-17/h1-3,7-8,16H,4-6,9-14H2/t16?,19?,20-/m0/s1 |
| InChIKey | YPWNLUXSWJNUED-GQOXECLESA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |