C13H15BrO4 — CID 90419521
ethyl 2-[3-(bromomethyl)phenyl]-1,3-dioxolane-2-carboxylate (PubChem CID 90419521) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is ethyl 2-[3-(bromomethyl)phenyl]-1,3-dioxolane-2-carboxylate.
| Compound Name | ethyl 2-[3-(bromomethyl)phenyl]-1,3-dioxolane-2-carboxylate |
|---|---|
| PubChem CID | 90419521 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | ethyl 2-[3-(bromomethyl)phenyl]-1,3-dioxolane-2-carboxylate |
| SMILES | CCOC(=O)C1(c2cccc(CBr)c2)OCCO1 |
| InChI | InChI=1S/C13H15BrO4/c1-2-16-12(15)13(17-6-7-18-13)11-5-3-4-10(8-11)9-14/h3-5,8H,2,6-7,9H2,1H3 |
| InChIKey | YQBBNUWHOLQMNM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|