C15H19FO3 — CID 114873122
ethyl 2,3-diethyl-3-(3-fluorophenyl)oxirane-2-carboxylate (PubChem CID 114873122) has the molecular formula C15H19FO3 and a molecular weight of 266.31 g/mol. Its IUPAC name is ethyl 2,3-diethyl-3-(3-fluorophenyl)oxirane-2-carboxylate.
| Compound Name | ethyl 2,3-diethyl-3-(3-fluorophenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 114873122 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | ethyl 2,3-diethyl-3-(3-fluorophenyl)oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1(CC)OC1(CC)c1cccc(F)c1 |
| InChI | InChI=1S/C15H19FO3/c1-4-14(11-8-7-9-12(16)10-11)15(5-2,19-14)13(17)18-6-3/h7-10H,4-6H2,1-3H3 |
| InChIKey | RCPNVAXPAFXMTO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|