C14H17ClO3 — CID 12932111
ethyl 2-[3-(3-chlorophenyl)propyl]oxirane-2-carboxylate (PubChem CID 12932111) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is ethyl 2-[3-(3-chlorophenyl)propyl]oxirane-2-carboxylate.
| Compound Name | ethyl 2-[3-(3-chlorophenyl)propyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 12932111 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | ethyl 2-[3-(3-chlorophenyl)propyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1(CCCc2cccc(Cl)c2)CO1 |
| InChI | InChI=1S/C14H17ClO3/c1-2-17-13(16)14(10-18-14)8-4-6-11-5-3-7-12(15)9-11/h3,5,7,9H,2,4,6,8,10H2,1H3 |
| InChIKey | WHJDDJRYKKHYQG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|