About cyclopentane;ethyl 2-propyloxirane-2-carboxylate
cyclopentane;ethyl 2-propyloxirane-2-carboxylate (PubChem CID 88748989) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is cyclopentane;ethyl 2-propyloxirane-2-carboxylate.
Molecular Properties
| Compound Name | cyclopentane;ethyl 2-propyloxirane-2-carboxylate |
| PubChem CID | 88748989 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | cyclopentane;ethyl 2-propyloxirane-2-carboxylate |
| SMILES | C1CCCC1.CCCC1(C(=O)OCC)CO1 |
| InChI | InChI=1S/C8H14O3.C5H10/c1-3-5-8(6-11-8)7(9)10-4-2;1-2-4-5-3-1/h3-6H2,1-2H3;1-5H2 |
| InChIKey | YGRMOKRTDORWSM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;ethyl 2-propyloxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;ethyl 2-propyloxirane-2-carboxylate?
The IUPAC name of cyclopentane;ethyl 2-propyloxirane-2-carboxylate (CID 88748989) is cyclopentane;ethyl 2-propyloxirane-2-carboxylate.
What is the SMILES notation for cyclopentane;ethyl 2-propyloxirane-2-carboxylate?
The canonical SMILES for cyclopentane;ethyl 2-propyloxirane-2-carboxylate is C1CCCC1.CCCC1(C(=O)OCC)CO1.
What is the InChIKey of cyclopentane;ethyl 2-propyloxirane-2-carboxylate?
The InChIKey is YGRMOKRTDORWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.C5H10/c1-3-5-8(6-11-8)7(9)10-4-2;1-2-4-5-3-1/h3-6H2,1-2H3;1-5H2.
What are the key properties of cyclopentane;ethyl 2-propyloxirane-2-carboxylate?
cyclopentane;ethyl 2-propyloxirane-2-carboxylate has a molecular weight of 228.33 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;ethyl 2-propyloxirane-2-carboxylate is sourced from PubChem (CID 88748989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).