C7H10Cl2O3 — CID 10987602
ethyl 2-(2,2-dichloroethyl)oxirane-2-carboxylate (PubChem CID 10987602) has the molecular formula C7H10Cl2O3 and a molecular weight of 213.06 g/mol. Its IUPAC name is ethyl 2-(2,2-dichloroethyl)oxirane-2-carboxylate.
| Compound Name | ethyl 2-(2,2-dichloroethyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 10987602 |
| Molecular Formula | C7H10Cl2O3 |
| Molecular Weight | 213.06 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | ethyl 2-(2,2-dichloroethyl)oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1(CC(Cl)Cl)CO1 |
| InChI | InChI=1S/C7H10Cl2O3/c1-2-11-6(10)7(4-12-7)3-5(8)9/h5H,2-4H2,1H3 |
| InChIKey | OGWPWYMJVMXWMG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.06 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|