C15H24O7 — CID 10710500
diethyl 2-[(2-ethoxycarbonyl-3,3-dimethyloxiran-2-yl)methyl]propanedioate (PubChem CID 10710500) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is diethyl 2-[(2-ethoxycarbonyl-3,3-dimethyloxiran-2-yl)methyl]propanedioate.
| Compound Name | diethyl 2-[(2-ethoxycarbonyl-3,3-dimethyloxiran-2-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 10710500 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | diethyl 2-[(2-ethoxycarbonyl-3,3-dimethyloxiran-2-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(CC1(C(=O)OCC)OC1(C)C)C(=O)OCC |
| InChI | InChI=1S/C15H24O7/c1-6-19-11(16)10(12(17)20-7-2)9-15(13(18)21-8-3)14(4,5)22-15/h10H,6-9H2,1-5H3 |
| InChIKey | RLGNIJLGAFCTTF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|