C14H26O3 — CID 79299561
ethyl 2,3-diethyl-3-(2-methylbutyl)oxirane-2-carboxylate (PubChem CID 79299561) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is ethyl 2,3-diethyl-3-(2-methylbutyl)oxirane-2-carboxylate.
| Compound Name | ethyl 2,3-diethyl-3-(2-methylbutyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 79299561 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | ethyl 2,3-diethyl-3-(2-methylbutyl)oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1(CC)OC1(CC)CC(C)CC |
| InChI | InChI=1S/C14H26O3/c1-6-11(5)10-13(7-2)14(8-3,17-13)12(15)16-9-4/h11H,6-10H2,1-5H3 |
| InChIKey | HVMKZWKWSHGAKJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|