C13H24O3 — CID 79298033
ethyl 2-ethyl-3,3-dipropyloxirane-2-carboxylate (PubChem CID 79298033) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is ethyl 2-ethyl-3,3-dipropyloxirane-2-carboxylate.
| Compound Name | ethyl 2-ethyl-3,3-dipropyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 79298033 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | ethyl 2-ethyl-3,3-dipropyloxirane-2-carboxylate |
| SMILES | CCCC1(CCC)OC1(CC)C(=O)OCC |
| InChI | InChI=1S/C13H24O3/c1-5-9-12(10-6-2)13(7-3,16-12)11(14)15-8-4/h5-10H2,1-4H3 |
| InChIKey | SALRVVOWVLJQLT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|