C11H18O5S — CID 83046824
ethyl 6,6-dioxo-2-propyl-1-oxa-6λ6-thiaspiro[2.4]heptane-2-carboxylate (PubChem CID 83046824) has the molecular formula C11H18O5S and a molecular weight of 262.33 g/mol. Its IUPAC name is ethyl 6,6-dioxo-2-propyl-1-oxa-6λ6-thiaspiro[2.4]heptane-2-carboxylate.
| Compound Name | ethyl 6,6-dioxo-2-propyl-1-oxa-6λ6-thiaspiro[2.4]heptane-2-carboxylate |
|---|---|
| PubChem CID | 83046824 |
| Molecular Formula | C11H18O5S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | ethyl 6,6-dioxo-2-propyl-1-oxa-6λ6-thiaspiro[2.4]heptane-2-carboxylate |
| SMILES | CCCC1(C(=O)OCC)OC12CCS(=O)(=O)C2 |
| InChI | InChI=1S/C11H18O5S/c1-3-5-11(9(12)15-4-2)10(16-11)6-7-17(13,14)8-10/h3-8H2,1-2H3 |
| InChIKey | KOWRNAKUHNUMOV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|