C7H9ClO5S — CID 103354786
methyl 2-chloro-6,6-dioxo-1-oxa-6λ6-thiaspiro[2.4]heptane-2-carboxylate (PubChem CID 103354786) has the molecular formula C7H9ClO5S and a molecular weight of 240.66 g/mol. Its IUPAC name is methyl 2-chloro-6,6-dioxo-1-oxa-6λ6-thiaspiro[2.4]heptane-2-carboxylate.
| Compound Name | methyl 2-chloro-6,6-dioxo-1-oxa-6λ6-thiaspiro[2.4]heptane-2-carboxylate |
|---|---|
| PubChem CID | 103354786 |
| Molecular Formula | C7H9ClO5S |
| Molecular Weight | 240.66 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | methyl 2-chloro-6,6-dioxo-1-oxa-6λ6-thiaspiro[2.4]heptane-2-carboxylate |
| SMILES | COC(=O)C1(Cl)OC12CCS(=O)(=O)C2 |
| InChI | InChI=1S/C7H9ClO5S/c1-12-5(9)7(8)6(13-7)2-3-14(10,11)4-6/h2-4H2,1H3 |
| InChIKey | PBDVFYGNSWHFMO-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.66 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|