C8H12F2O4S — CID 165476267
methyl 4-(difluoromethyl)-1,1-dioxothiane-4-carboxylate (PubChem CID 165476267) has the molecular formula C8H12F2O4S and a molecular weight of 242.24 g/mol. Its IUPAC name is methyl 4-(difluoromethyl)-1,1-dioxothiane-4-carboxylate.
| Compound Name | methyl 4-(difluoromethyl)-1,1-dioxothiane-4-carboxylate |
|---|---|
| PubChem CID | 165476267 |
| Molecular Formula | C8H12F2O4S |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | methyl 4-(difluoromethyl)-1,1-dioxothiane-4-carboxylate |
| SMILES | COC(=O)C1(C(F)F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H12F2O4S/c1-14-7(11)8(6(9)10)2-4-15(12,13)5-3-8/h6H,2-5H2,1H3 |
| InChIKey | WWKVZFRPKRVXDO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |