C11H20N2O4S — CID 54981399
methyl 1,1-dioxo-4-piperazin-1-ylthiane-4-carboxylate (PubChem CID 54981399) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is methyl 1,1-dioxo-4-piperazin-1-ylthiane-4-carboxylate.
| Compound Name | methyl 1,1-dioxo-4-piperazin-1-ylthiane-4-carboxylate |
|---|---|
| PubChem CID | 54981399 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 1,1-dioxo-4-piperazin-1-ylthiane-4-carboxylate |
| SMILES | COC(=O)C1(N2CCNCC2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H20N2O4S/c1-17-10(14)11(13-6-4-12-5-7-13)2-8-18(15,16)9-3-11/h12H,2-9H2,1H3 |
| InChIKey | NXELBNJPLSIOHF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |