C11H18F2O4S — CID 84813121
methyl 4-butyl-3,3-difluoro-1,1-dioxothiane-4-carboxylate (PubChem CID 84813121) has the molecular formula C11H18F2O4S and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 4-butyl-3,3-difluoro-1,1-dioxothiane-4-carboxylate.
| Compound Name | methyl 4-butyl-3,3-difluoro-1,1-dioxothiane-4-carboxylate |
|---|---|
| PubChem CID | 84813121 |
| Molecular Formula | C11H18F2O4S |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | methyl 4-butyl-3,3-difluoro-1,1-dioxothiane-4-carboxylate |
| SMILES | CCCCC1(C(=O)OC)CCS(=O)(=O)CC1(F)F |
| InChI | InChI=1S/C11H18F2O4S/c1-3-4-5-10(9(14)17-2)6-7-18(15,16)8-11(10,12)13/h3-8H2,1-2H3 |
| InChIKey | MCKWPTPSVGZCGO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |