C10H16F2O4S — CID 84809118
4-butyl-3,3-difluoro-1,1-dioxothiane-4-carboxylic acid (PubChem CID 84809118) has the molecular formula C10H16F2O4S and a molecular weight of 270.30 g/mol. Its IUPAC name is 4-butyl-3,3-difluoro-1,1-dioxothiane-4-carboxylic acid.
| Compound Name | 4-butyl-3,3-difluoro-1,1-dioxothiane-4-carboxylic acid |
|---|---|
| PubChem CID | 84809118 |
| Molecular Formula | C10H16F2O4S |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-butyl-3,3-difluoro-1,1-dioxothiane-4-carboxylic acid |
| SMILES | CCCCC1(C(=O)O)CCS(=O)(=O)CC1(F)F |
| InChI | InChI=1S/C10H16F2O4S/c1-2-3-4-9(8(13)14)5-6-17(15,16)7-10(9,11)12/h2-7H2,1H3,(H,13,14) |
| InChIKey | JZBBRIUZKJNYBI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |