C11H18O7S — CID 63166217
diethyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)propanedioate (PubChem CID 63166217) has the molecular formula C11H18O7S and a molecular weight of 294.32 g/mol. Its IUPAC name is diethyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)propanedioate.
| Compound Name | diethyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)propanedioate |
|---|---|
| PubChem CID | 63166217 |
| Molecular Formula | C11H18O7S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | diethyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H18O7S/c1-3-17-9(12)8(10(13)18-4-2)11(14)5-6-19(15,16)7-11/h8,14H,3-7H2,1-2H3 |
| InChIKey | HWPWWKNNDILJKS-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|