ethyl 2,2-bis(4-methyloxan-4-yl)acetate

C16H28O4 — CID 175344737

IUPACethyl 2,2-bis(4-methyloxan-4-yl)acetate
SMILESCCOC(=O)C(C1(C)CCOCC1)C1(C)CCOCC1
InChIInChI=1S/C16H28O4/c1-4-20-14(17)13(15(2)5-9-18-10-6-15)16(3)7-11-19-12-8-16/h13H,4-12H2,1-3H3
InChIKeyLXKXKJXXTGXVOW-UHFFFAOYSA-N
MW284.40 g/mol
LogP2.80
Rot. Bonds4

About ethyl 2,2-bis(4-methyloxan-4-yl)acetate

ethyl 2,2-bis(4-methyloxan-4-yl)acetate (PubChem CID 175344737) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl 2,2-bis(4-methyloxan-4-yl)acetate.

Molecular Properties

Compound Nameethyl 2,2-bis(4-methyloxan-4-yl)acetate
PubChem CID175344737
Molecular FormulaC16H28O4
Molecular Weight284.40 g/mol
Exact Mass284.20
IUPAC Nameethyl 2,2-bis(4-methyloxan-4-yl)acetate
SMILESCCOC(=O)C(C1(C)CCOCC1)C1(C)CCOCC1
InChIInChI=1S/C16H28O4/c1-4-20-14(17)13(15(2)5-9-18-10-6-15)16(3)7-11-19-12-8-16/h13H,4-12H2,1-3H3
InChIKeyLXKXKJXXTGXVOW-UHFFFAOYSA-N
XLogP2.80
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 52.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2,2-bis(4-methyloxan-4-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,2-bis(4-methyloxan-4-yl)acetate?
The IUPAC name of ethyl 2,2-bis(4-methyloxan-4-yl)acetate (CID 175344737) is ethyl 2,2-bis(4-methyloxan-4-yl)acetate.
What is the SMILES notation for ethyl 2,2-bis(4-methyloxan-4-yl)acetate?
The canonical SMILES for ethyl 2,2-bis(4-methyloxan-4-yl)acetate is CCOC(=O)C(C1(C)CCOCC1)C1(C)CCOCC1.
What is the InChIKey of ethyl 2,2-bis(4-methyloxan-4-yl)acetate?
The InChIKey is LXKXKJXXTGXVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-4-20-14(17)13(15(2)5-9-18-10-6-15)16(3)7-11-19-12-8-16/h13H,4-12H2,1-3H3.
What are the key properties of ethyl 2,2-bis(4-methyloxan-4-yl)acetate?
ethyl 2,2-bis(4-methyloxan-4-yl)acetate has a molecular weight of 284.40 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-bis(4-methyloxan-4-yl)acetate is sourced from PubChem (CID 175344737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).