About diethyl 2-methylpropanedioate;oxolane
diethyl 2-methylpropanedioate;oxolane (PubChem CID 174718682) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is diethyl 2-methylpropanedioate;oxolane.
Molecular Properties
| Compound Name | diethyl 2-methylpropanedioate;oxolane |
| PubChem CID | 174718682 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | diethyl 2-methylpropanedioate;oxolane |
| SMILES | C1CCOC1.CCOC(=O)C(C)C(=O)OCC |
| InChI | InChI=1S/C8H14O4.C4H8O/c1-4-11-7(9)6(3)8(10)12-5-2;1-2-4-5-3-1/h6H,4-5H2,1-3H3;1-4H2 |
| InChIKey | FPFWKCNRDJPXQA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-methylpropanedioate;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-methylpropanedioate;oxolane?
The IUPAC name of diethyl 2-methylpropanedioate;oxolane (CID 174718682) is diethyl 2-methylpropanedioate;oxolane.
What is the SMILES notation for diethyl 2-methylpropanedioate;oxolane?
The canonical SMILES for diethyl 2-methylpropanedioate;oxolane is C1CCOC1.CCOC(=O)C(C)C(=O)OCC.
What is the InChIKey of diethyl 2-methylpropanedioate;oxolane?
The InChIKey is FPFWKCNRDJPXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4.C4H8O/c1-4-11-7(9)6(3)8(10)12-5-2;1-2-4-5-3-1/h6H,4-5H2,1-3H3;1-4H2.
What are the key properties of diethyl 2-methylpropanedioate;oxolane?
diethyl 2-methylpropanedioate;oxolane has a molecular weight of 246.30 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-methylpropanedioate;oxolane is sourced from PubChem (CID 174718682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).