C19H34Br2O3 — CID 22753985
ethyl 2-(4,5-dibromotetradecyl)oxirane-2-carboxylate (PubChem CID 22753985) has the molecular formula C19H34Br2O3 and a molecular weight of 470.29 g/mol. Its IUPAC name is ethyl 2-(4,5-dibromotetradecyl)oxirane-2-carboxylate.
| Compound Name | ethyl 2-(4,5-dibromotetradecyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 22753985 |
| Molecular Formula | C19H34Br2O3 |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | ethyl 2-(4,5-dibromotetradecyl)oxirane-2-carboxylate |
| SMILES | CCCCCCCCCC(Br)C(Br)CCCC1(C(=O)OCC)CO1 |
| InChI | InChI=1S/C19H34Br2O3/c1-3-5-6-7-8-9-10-12-16(20)17(21)13-11-14-19(15-24-19)18(22)23-4-2/h16-17H,3-15H2,1-2H3 |
| InChIKey | MZDJOZLYUOIHHA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|