C15H22O — CID 116542607
2-methyl-1-(3-propylphenyl)cyclopentan-1-ol (PubChem CID 116542607) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-methyl-1-(3-propylphenyl)cyclopentan-1-ol.
| Compound Name | 2-methyl-1-(3-propylphenyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 116542607 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-methyl-1-(3-propylphenyl)cyclopentan-1-ol |
| SMILES | CCCc1cccc(C2(O)CCCC2C)c1 |
| InChI | InChI=1S/C15H22O/c1-3-6-13-8-4-9-14(11-13)15(16)10-5-7-12(15)2/h4,8-9,11-12,16H,3,5-7,10H2,1-2H3 |
| InChIKey | UFWVBIRYMNGRAJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |