C17H26O — CID 116542580
3,3-dimethyl-1-(3-propylphenyl)cyclohexan-1-ol (PubChem CID 116542580) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3-propylphenyl)cyclohexan-1-ol.
| Compound Name | 3,3-dimethyl-1-(3-propylphenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 116542580 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 3,3-dimethyl-1-(3-propylphenyl)cyclohexan-1-ol |
| SMILES | CCCc1cccc(C2(O)CCCC(C)(C)C2)c1 |
| InChI | InChI=1S/C17H26O/c1-4-7-14-8-5-9-15(12-14)17(18)11-6-10-16(2,3)13-17/h5,8-9,12,18H,4,6-7,10-11,13H2,1-3H3 |
| InChIKey | SIYCTUQSNVQKKO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |