C17H24O — CID 114601509
1-(3-cyclobutylphenyl)-3,3-dimethylcyclopentan-1-ol (PubChem CID 114601509) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(3-cyclobutylphenyl)-3,3-dimethylcyclopentan-1-ol.
| Compound Name | 1-(3-cyclobutylphenyl)-3,3-dimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 114601509 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(3-cyclobutylphenyl)-3,3-dimethylcyclopentan-1-ol |
| SMILES | CC1(C)CCC(O)(c2cccc(C3CCC3)c2)C1 |
| InChI | InChI=1S/C17H24O/c1-16(2)9-10-17(18,12-16)15-8-4-7-14(11-15)13-5-3-6-13/h4,7-8,11,13,18H,3,5-6,9-10,12H2,1-2H3 |
| InChIKey | OHSHCECWRPBMHX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |