C15H21ClO2 — CID 79700558
1-(4-chloro-3-methoxyphenyl)-3,3-dimethylcyclohexan-1-ol (PubChem CID 79700558) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-3,3-dimethylcyclohexan-1-ol.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-3,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 79700558 |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-3,3-dimethylcyclohexan-1-ol |
| SMILES | COc1cc(C2(O)CCCC(C)(C)C2)ccc1Cl |
| InChI | InChI=1S/C15H21ClO2/c1-14(2)7-4-8-15(17,10-14)11-5-6-12(16)13(9-11)18-3/h5-6,9,17H,4,7-8,10H2,1-3H3 |
| InChIKey | MHYAGOAPGHXNQW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |