C12H17ClOS — CID 107359043
1-(3-chlorothiophen-2-yl)-3,3-dimethylcyclohexan-1-ol (PubChem CID 107359043) has the molecular formula C12H17ClOS and a molecular weight of 244.79 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-3,3-dimethylcyclohexan-1-ol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-3,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 107359043 |
| Molecular Formula | C12H17ClOS |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-3,3-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CCCC(O)(c2sccc2Cl)C1 |
| InChI | InChI=1S/C12H17ClOS/c1-11(2)5-3-6-12(14,8-11)10-9(13)4-7-15-10/h4,7,14H,3,5-6,8H2,1-2H3 |
| InChIKey | AJFGDEMHKACRDZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |