C13H19ClOS — CID 107359119
1-(3-chlorothiophen-2-yl)-2,4,4-trimethylcyclohexan-1-ol (PubChem CID 107359119) has the molecular formula C13H19ClOS and a molecular weight of 258.81 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-2,4,4-trimethylcyclohexan-1-ol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-2,4,4-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 107359119 |
| Molecular Formula | C13H19ClOS |
| Molecular Weight | 258.81 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-2,4,4-trimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)(C)CCC1(O)c1sccc1Cl |
| InChI | InChI=1S/C13H19ClOS/c1-9-8-12(2,3)5-6-13(9,15)11-10(14)4-7-16-11/h4,7,9,15H,5-6,8H2,1-3H3 |
| InChIKey | QMJKXVBHIXTALT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |