C13H22N2O — CID 103130256
2,4,4-trimethyl-1-(1-methylpyrazol-3-yl)cyclohexan-1-ol (PubChem CID 103130256) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,4,4-trimethyl-1-(1-methylpyrazol-3-yl)cyclohexan-1-ol.
| Compound Name | 2,4,4-trimethyl-1-(1-methylpyrazol-3-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 103130256 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2,4,4-trimethyl-1-(1-methylpyrazol-3-yl)cyclohexan-1-ol |
| SMILES | CC1CC(C)(C)CCC1(O)c1ccn(C)n1 |
| InChI | InChI=1S/C13H22N2O/c1-10-9-12(2,3)6-7-13(10,16)11-5-8-15(4)14-11/h5,8,10,16H,6-7,9H2,1-4H3 |
| InChIKey | VFEOMLBKSKHPDN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |