C15H19BrF2O — CID 106941425
1-(3-bromo-2,6-difluorophenyl)-2,4,4-trimethylcyclohexan-1-ol (PubChem CID 106941425) has the molecular formula C15H19BrF2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2,4,4-trimethylcyclohexan-1-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2,4,4-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 106941425 |
| Molecular Formula | C15H19BrF2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2,4,4-trimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)(C)CCC1(O)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H19BrF2O/c1-9-8-14(2,3)6-7-15(9,19)12-11(17)5-4-10(16)13(12)18/h4-5,9,19H,6-8H2,1-3H3 |
| InChIKey | WAEMLPVKZWACHK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|