C13H16BrF2N — CID 106941617
1-(3-bromo-2,6-difluorophenyl)-3,3-dimethylcyclopentan-1-amine (PubChem CID 106941617) has the molecular formula C13H16BrF2N and a molecular weight of 304.18 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3,3-dimethylcyclopentan-1-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3,3-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 106941617 |
| Molecular Formula | C13H16BrF2N |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3,3-dimethylcyclopentan-1-amine |
| SMILES | CC1(C)CCC(N)(c2c(F)ccc(Br)c2F)C1 |
| InChI | InChI=1S/C13H16BrF2N/c1-12(2)5-6-13(17,7-12)10-9(15)4-3-8(14)11(10)16/h3-4H,5-7,17H2,1-2H3 |
| InChIKey | YARKKQWPWRAXLZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|