C15H20BrF2NO — CID 106943803
1-(3-bromo-2,6-difluorophenyl)-4-(propylamino)cyclohexan-1-ol (PubChem CID 106943803) has the molecular formula C15H20BrF2NO and a molecular weight of 348.23 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-4-(propylamino)cyclohexan-1-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-4-(propylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 106943803 |
| Molecular Formula | C15H20BrF2NO |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-4-(propylamino)cyclohexan-1-ol |
| SMILES | CCCNC1CCC(O)(c2c(F)ccc(Br)c2F)CC1 |
| InChI | InChI=1S/C15H20BrF2NO/c1-2-9-19-10-5-7-15(20,8-6-10)13-12(17)4-3-11(16)14(13)18/h3-4,10,19-20H,2,5-9H2,1H3 |
| InChIKey | OXFWIFZLADHICF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|